C46H38N2 — CID 89068114
3-methyl-N-(3-methylphenyl)-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline (PubChem CID 89068114) has the molecular formula C46H38N2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 3-methyl-N-(3-methylphenyl)-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline.
| Compound Name | 3-methyl-N-(3-methylphenyl)-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 89068114 |
| Molecular Formula | C46H38N2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 3-methyl-N-(3-methylphenyl)-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline |
| SMILES | Cc1cccc(N(c2ccc(/C=C/c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)cc2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C46H38N2/c1-35-11-9-17-45(33-35)48(46-18-10-12-36(2)34-46)43-29-23-38(24-30-43)20-19-37-21-25-39(26-22-37)40-27-31-44(32-28-40)47(41-13-5-3-6-14-41)42-15-7-4-8-16-42/h3-34H,1-2H3/b20-19+ |
| InChIKey | ZJYLYCHNDHHRCV-FMQUCBEESA-N |
| XLogP | 13.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|