C37H33N — CID 58785033
4-methyl-N-(4-methylphenyl)-N-[4-[2-[4-(4-prop-1-enylphenyl)phenyl]ethenyl]phenyl]aniline (PubChem CID 58785033) has the molecular formula C37H33N and a molecular weight of 491.68 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[4-[2-[4-(4-prop-1-enylphenyl)phenyl]ethenyl]phenyl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[4-[2-[4-(4-prop-1-enylphenyl)phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 58785033 |
| Molecular Formula | C37H33N |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[4-[2-[4-(4-prop-1-enylphenyl)phenyl]ethenyl]phenyl]aniline |
| SMILES | CC=Cc1ccc(-c2ccc(C=Cc3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H33N/c1-4-5-30-12-18-33(19-13-30)34-20-14-31(15-21-34)10-11-32-16-26-37(27-17-32)38(35-22-6-28(2)7-23-35)36-24-8-29(3)9-25-36/h4-27H,1-3H3 |
| InChIKey | MJEOLBPCYPCEJM-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|