C49H44N2 — CID 89067836
N-(4-tert-butylphenyl)-4-methyl-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline (PubChem CID 89067836) has the molecular formula C49H44N2 and a molecular weight of 660.91 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-methyl-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline.
| Compound Name | N-(4-tert-butylphenyl)-4-methyl-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 89067836 |
| Molecular Formula | C49H44N2 |
| Molecular Weight | 660.91 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-methyl-N-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccc(/C=C/c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C49H44N2/c1-37-15-29-45(30-16-37)51(48-35-27-42(28-36-48)49(2,3)4)46-31-21-39(22-32-46)18-17-38-19-23-40(24-20-38)41-25-33-47(34-26-41)50(43-11-7-5-8-12-43)44-13-9-6-10-14-44/h5-36H,1-4H3/b18-17+ |
| InChIKey | LKFAERLFWGFWMN-ISLYRVAYSA-N |
| XLogP | 14.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.91 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|