C33H37N — CID 134425789
N-(4-tert-butylphenyl)-N-[4-(4-tert-butylphenyl)phenyl]-4-methylaniline (PubChem CID 134425789) has the molecular formula C33H37N and a molecular weight of 447.67 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-[4-(4-tert-butylphenyl)phenyl]-4-methylaniline.
| Compound Name | N-(4-tert-butylphenyl)-N-[4-(4-tert-butylphenyl)phenyl]-4-methylaniline |
|---|---|
| PubChem CID | 134425789 |
| Molecular Formula | C33H37N |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[4-(4-tert-butylphenyl)phenyl]-4-methylaniline |
| SMILES | Cc1ccc(N(c2ccc(-c3ccc(C(C)(C)C)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H37N/c1-24-8-18-29(19-9-24)34(31-22-16-28(17-23-31)33(5,6)7)30-20-12-26(13-21-30)25-10-14-27(15-11-25)32(2,3)4/h8-23H,1-7H3 |
| InChIKey | LQAZKBQLLUWRGV-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |