C44H37N — CID 166032564
17-(4-tert-butylphenyl)-N,N-bis(4-methylphenyl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine (PubChem CID 166032564) has the molecular formula C44H37N and a molecular weight of 579.79 g/mol. Its IUPAC name is 17-(4-tert-butylphenyl)-N,N-bis(4-methylphenyl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine.
| Compound Name | 17-(4-tert-butylphenyl)-N,N-bis(4-methylphenyl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine |
|---|---|
| PubChem CID | 166032564 |
| Molecular Formula | C44H37N |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 17-(4-tert-butylphenyl)-N,N-bis(4-methylphenyl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3cc4c(cc3c2)-c2cc3cc(-c5ccc(C(C)(C)C)cc5)ccc3cc2-4)cc1 |
| InChI | InChI=1S/C44H37N/c1-28-6-17-37(18-7-28)45(38-19-8-29(2)9-20-38)39-21-14-33-25-41-40-24-32-11-10-31(30-12-15-36(16-13-30)44(3,4)5)22-34(32)26-42(40)43(41)27-35(33)23-39/h6-27H,1-5H3 |
| InChIKey | JDQNHUZQGLECTC-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |