C46H47N — CID 59863422
N,N-bis[4-(4-tert-butylphenyl)phenyl]-4-(4-ethylphenyl)aniline (PubChem CID 59863422) has the molecular formula C46H47N and a molecular weight of 613.89 g/mol. Its IUPAC name is N,N-bis[4-(4-tert-butylphenyl)phenyl]-4-(4-ethylphenyl)aniline.
| Compound Name | N,N-bis[4-(4-tert-butylphenyl)phenyl]-4-(4-ethylphenyl)aniline |
|---|---|
| PubChem CID | 59863422 |
| Molecular Formula | C46H47N |
| Molecular Weight | 613.89 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | N,N-bis[4-(4-tert-butylphenyl)phenyl]-4-(4-ethylphenyl)aniline |
| SMILES | CCc1ccc(-c2ccc(N(c3ccc(-c4ccc(C(C)(C)C)cc4)cc3)c3ccc(-c4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H47N/c1-8-33-9-11-34(12-10-33)37-17-27-42(28-18-37)47(43-29-19-38(20-30-43)35-13-23-40(24-14-35)45(2,3)4)44-31-21-39(22-32-44)36-15-25-41(26-16-36)46(5,6)7/h9-32H,8H2,1-7H3 |
| InChIKey | BEZKORUERYYCTN-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.89 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |