C28H31N — CID 159225256
N-(4-buta-1,3-dien-2-ylphenyl)-N-(4-tert-butylphenyl)-4-ethylaniline (PubChem CID 159225256) has the molecular formula C28H31N and a molecular weight of 381.56 g/mol. Its IUPAC name is N-(4-buta-1,3-dien-2-ylphenyl)-N-(4-tert-butylphenyl)-4-ethylaniline.
| Compound Name | N-(4-buta-1,3-dien-2-ylphenyl)-N-(4-tert-butylphenyl)-4-ethylaniline |
|---|---|
| PubChem CID | 159225256 |
| Molecular Formula | C28H31N |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | N-(4-buta-1,3-dien-2-ylphenyl)-N-(4-tert-butylphenyl)-4-ethylaniline |
| SMILES | C=CC(=C)c1ccc(N(c2ccc(CC)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H31N/c1-7-21(3)23-11-17-26(18-12-23)29(25-15-9-22(8-2)10-16-25)27-19-13-24(14-20-27)28(4,5)6/h7,9-20H,1,3,8H2,2,4-6H3 |
| InChIKey | KSEZHMFFNZOGGO-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|