About ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene
ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene (PubChem CID 143259588) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene |
| PubChem CID | 143259588 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene |
| SMILES | C=C/C=C\C(=C)c1ccc(CC)cc1.CC |
| InChI | InChI=1S/C14H16.C2H6/c1-4-6-7-12(3)14-10-8-13(5-2)9-11-14;1-2/h4,6-11H,1,3,5H2,2H3;1-2H3/b7-6-; |
| InChIKey | HPHFSWIFODONBG-NAFXZHHSSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene?
The IUPAC name of ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene (CID 143259588) is ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene.
What is the SMILES notation for ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene?
The canonical SMILES for ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene is C=C/C=C\C(=C)c1ccc(CC)cc1.CC.
What is the InChIKey of ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene?
The InChIKey is HPHFSWIFODONBG-NAFXZHHSSA-N. The full InChI is InChI=1S/C14H16.C2H6/c1-4-6-7-12(3)14-10-8-13(5-2)9-11-14;1-2/h4,6-11H,1,3,5H2,2H3;1-2H3/b7-6-;.
What are the key properties of ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene?
ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene has a molecular weight of 214.35 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene is sourced from PubChem (CID 143259588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).