C16H22 — CID 143259588
ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene (PubChem CID 143259588) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene.
| Compound Name | ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 143259588 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | ethane;1-ethyl-4-[(3Z)-hexa-1,3,5-trien-2-yl]benzene |
| SMILES | C=C/C=C\C(=C)c1ccc(CC)cc1.CC |
| InChI | InChI=1S/C14H16.C2H6/c1-4-6-7-12(3)14-10-8-13(5-2)9-11-14;1-2/h4,6-11H,1,3,5H2,2H3;1-2H3/b7-6-; |
| InChIKey | HPHFSWIFODONBG-NAFXZHHSSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|