About ethylbenzene;(3Z)-5-methylideneocta-1,3-diene
ethylbenzene;(3Z)-5-methylideneocta-1,3-diene (PubChem CID 142937087) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is ethylbenzene;(3Z)-5-methylideneocta-1,3-diene.
Molecular Properties
| Compound Name | ethylbenzene;(3Z)-5-methylideneocta-1,3-diene |
| PubChem CID | 142937087 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethylbenzene;(3Z)-5-methylideneocta-1,3-diene |
| SMILES | C=C/C=C\C(=C)CCC.CCc1ccccc1 |
| InChI | InChI=1S/C9H14.C8H10/c1-4-6-8-9(3)7-5-2;1-2-8-6-4-3-5-7-8/h4,6,8H,1,3,5,7H2,2H3;3-7H,2H2,1H3/b8-6-; |
| InChIKey | GOGZGXPWWWIGNP-PHZXCRFESA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;(3Z)-5-methylideneocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;(3Z)-5-methylideneocta-1,3-diene?
The IUPAC name of ethylbenzene;(3Z)-5-methylideneocta-1,3-diene (CID 142937087) is ethylbenzene;(3Z)-5-methylideneocta-1,3-diene.
What is the SMILES notation for ethylbenzene;(3Z)-5-methylideneocta-1,3-diene?
The canonical SMILES for ethylbenzene;(3Z)-5-methylideneocta-1,3-diene is C=C/C=C\C(=C)CCC.CCc1ccccc1.
What is the InChIKey of ethylbenzene;(3Z)-5-methylideneocta-1,3-diene?
The InChIKey is GOGZGXPWWWIGNP-PHZXCRFESA-N. The full InChI is InChI=1S/C9H14.C8H10/c1-4-6-8-9(3)7-5-2;1-2-8-6-4-3-5-7-8/h4,6,8H,1,3,5,7H2,2H3;3-7H,2H2,1H3/b8-6-;.
What are the key properties of ethylbenzene;(3Z)-5-methylideneocta-1,3-diene?
ethylbenzene;(3Z)-5-methylideneocta-1,3-diene has a molecular weight of 228.38 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;(3Z)-5-methylideneocta-1,3-diene is sourced from PubChem (CID 142937087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).