C17H24 — CID 142937087
ethylbenzene;(3Z)-5-methylideneocta-1,3-diene (PubChem CID 142937087) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is ethylbenzene;(3Z)-5-methylideneocta-1,3-diene.
| Compound Name | ethylbenzene;(3Z)-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 142937087 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethylbenzene;(3Z)-5-methylideneocta-1,3-diene |
| SMILES | C=C/C=C\C(=C)CCC.CCc1ccccc1 |
| InChI | InChI=1S/C9H14.C8H10/c1-4-6-8-9(3)7-5-2;1-2-8-6-4-3-5-7-8/h4,6,8H,1,3,5,7H2,2H3;3-7H,2H2,1H3/b8-6-; |
| InChIKey | GOGZGXPWWWIGNP-PHZXCRFESA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|