C21H29NO — CID 142043593
N-[(9Z)-8-methylidene-1-phenyldodeca-9,11-dien-4-yl]acetamide (PubChem CID 142043593) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[(9Z)-8-methylidene-1-phenyldodeca-9,11-dien-4-yl]acetamide.
| Compound Name | N-[(9Z)-8-methylidene-1-phenyldodeca-9,11-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 142043593 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-[(9Z)-8-methylidene-1-phenyldodeca-9,11-dien-4-yl]acetamide |
| SMILES | C=C/C=C\C(=C)CCCC(CCCc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C21H29NO/c1-4-5-11-18(2)12-9-16-21(22-19(3)23)17-10-15-20-13-7-6-8-14-20/h4-8,11,13-14,21H,1-2,9-10,12,15-17H2,3H3,(H,22,23)/b11-5- |
| InChIKey | YULTZXMFBXMFHV-WZUFQYTHSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|