C20H29N — CID 142137977
(8Z,9Z)-8-ethylidene-1-phenyldodeca-9,11-dien-4-amine (PubChem CID 142137977) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (8Z,9Z)-8-ethylidene-1-phenyldodeca-9,11-dien-4-amine.
| Compound Name | (8Z,9Z)-8-ethylidene-1-phenyldodeca-9,11-dien-4-amine |
|---|---|
| PubChem CID | 142137977 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (8Z,9Z)-8-ethylidene-1-phenyldodeca-9,11-dien-4-amine |
| SMILES | C=C/C=C\C(=C/C)CCCC(N)CCCc1ccccc1 |
| InChI | InChI=1S/C20H29N/c1-3-5-11-18(4-2)14-9-16-20(21)17-10-15-19-12-7-6-8-13-19/h3-8,11-13,20H,1,9-10,14-17,21H2,2H3/b11-5-,18-4+ |
| InChIKey | YEPUFTGBHCUIMN-HTMOVGKDSA-N |
| XLogP | 5.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|