C14H20O2 — CID 118075336
(3R,5R)-8-phenyloct-1-ene-3,5-diol (PubChem CID 118075336) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (3R,5R)-8-phenyloct-1-ene-3,5-diol.
| Compound Name | (3R,5R)-8-phenyloct-1-ene-3,5-diol |
|---|---|
| PubChem CID | 118075336 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3R,5R)-8-phenyloct-1-ene-3,5-diol |
| SMILES | C=C[C@H](O)C[C@H](O)CCCc1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-2-13(15)11-14(16)10-6-9-12-7-4-3-5-8-12/h2-5,7-8,13-16H,1,6,9-11H2/t13-,14+/m0/s1 |
| InChIKey | KPZFDESEELGDEK-UONOGXRCSA-N |
| XLogP | 2.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|