C14H20O2 — CID 102019922
(2S,4R)-1-phenyloct-7-ene-2,4-diol (PubChem CID 102019922) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2S,4R)-1-phenyloct-7-ene-2,4-diol.
| Compound Name | (2S,4R)-1-phenyloct-7-ene-2,4-diol |
|---|---|
| PubChem CID | 102019922 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2S,4R)-1-phenyloct-7-ene-2,4-diol |
| SMILES | C=CCC[C@@H](O)C[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-2-3-9-13(15)11-14(16)10-12-7-5-4-6-8-12/h2,4-8,13-16H,1,3,9-11H2/t13-,14+/m1/s1 |
| InChIKey | TZZXYKUFXJJYNL-KGLIPLIRSA-N |
| XLogP | 2.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|