C19H32O2Si — CID 122388230
(2R,4S)-1-phenyl-4-triethylsilyloxyhept-6-en-2-ol (PubChem CID 122388230) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (2R,4S)-1-phenyl-4-triethylsilyloxyhept-6-en-2-ol.
| Compound Name | (2R,4S)-1-phenyl-4-triethylsilyloxyhept-6-en-2-ol |
|---|---|
| PubChem CID | 122388230 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2R,4S)-1-phenyl-4-triethylsilyloxyhept-6-en-2-ol |
| SMILES | C=CC[C@@H](C[C@H](O)Cc1ccccc1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H32O2Si/c1-5-12-19(21-22(6-2,7-3)8-4)16-18(20)15-17-13-10-9-11-14-17/h5,9-11,13-14,18-20H,1,6-8,12,15-16H2,2-4H3/t18-,19+/m1/s1 |
| InChIKey | FKSZPRCCRNYCGZ-MOPGFXCFSA-N |
| XLogP | 4.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|