About ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene
ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene (PubChem CID 175241821) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene.
Molecular Properties
| Compound Name | ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene |
| PubChem CID | 175241821 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene |
| SMILES | C=CCC(CCCC)OO.CCc1ccccc1.OO |
| InChI | InChI=1S/C8H16O2.C8H10.H2O2/c1-3-5-7-8(10-9)6-4-2;1-2-8-6-4-3-5-7-8;1-2/h4,8-9H,2-3,5-7H2,1H3;3-7H,2H2,1H3;1-2H |
| InChIKey | JZHQGJUIJBNEGQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene?
The IUPAC name of ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene (CID 175241821) is ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene.
What is the SMILES notation for ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene?
The canonical SMILES for ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene is C=CCC(CCCC)OO.CCc1ccccc1.OO.
What is the InChIKey of ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene?
The InChIKey is JZHQGJUIJBNEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C8H10.H2O2/c1-3-5-7-8(10-9)6-4-2;1-2-8-6-4-3-5-7-8;1-2/h4,8-9H,2-3,5-7H2,1H3;3-7H,2H2,1H3;1-2H.
What are the key properties of ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene?
ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene has a molecular weight of 284.40 g/mol, XLogP of 4.88, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;hydrogen peroxide;4-hydroperoxyoct-1-ene is sourced from PubChem (CID 175241821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).