About oct-1-en-4-ylbenzene
oct-1-en-4-ylbenzene (PubChem CID 22247233) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is oct-1-en-4-ylbenzene.
Molecular Properties
| Compound Name | oct-1-en-4-ylbenzene |
| PubChem CID | 22247233 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | oct-1-en-4-ylbenzene |
| SMILES | C=CCC(CCCC)c1ccccc1 |
| InChI | InChI=1S/C14H20/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14/h4,6-8,11-13H,2-3,5,9-10H2,1H3 |
| InChIKey | LKSZOQMZRIERKX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-1-en-4-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-en-4-ylbenzene?
The IUPAC name of oct-1-en-4-ylbenzene (CID 22247233) is oct-1-en-4-ylbenzene.
What is the SMILES notation for oct-1-en-4-ylbenzene?
The canonical SMILES for oct-1-en-4-ylbenzene is C=CCC(CCCC)c1ccccc1.
What is the InChIKey of oct-1-en-4-ylbenzene?
The InChIKey is LKSZOQMZRIERKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14/h4,6-8,11-13H,2-3,5,9-10H2,1H3.
What are the key properties of oct-1-en-4-ylbenzene?
oct-1-en-4-ylbenzene has a molecular weight of 188.31 g/mol, XLogP of 4.54, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-en-4-ylbenzene is sourced from PubChem (CID 22247233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).