About heptan-3-ylbenzene;methane
heptan-3-ylbenzene;methane (PubChem CID 159006232) has the molecular formula C21H52
and a molecular weight of 304.65 g/mol. Its IUPAC name is heptan-3-ylbenzene;methane.
Molecular Properties
| Compound Name | heptan-3-ylbenzene;methane |
| PubChem CID | 159006232 |
| Molecular Formula | C21H52 |
| Molecular Weight | 304.65 g/mol |
| Exact Mass | 304.41 |
| IUPAC Name | heptan-3-ylbenzene;methane |
| SMILES | C.C.C.C.C.C.C.C.CCCCC(CC)c1ccccc1 |
| InChI | InChI=1S/C13H20.8CH4/c1-3-5-9-12(4-2)13-10-7-6-8-11-13;;;;;;;;/h6-8,10-12H,3-5,9H2,1-2H3;8*1H4 |
| InChIKey | JRYLCGMHJYEYFH-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.65 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze heptan-3-ylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-3-ylbenzene;methane?
The IUPAC name of heptan-3-ylbenzene;methane (CID 159006232) is heptan-3-ylbenzene;methane.
What is the SMILES notation for heptan-3-ylbenzene;methane?
The canonical SMILES for heptan-3-ylbenzene;methane is C.C.C.C.C.C.C.C.CCCCC(CC)c1ccccc1.
What is the InChIKey of heptan-3-ylbenzene;methane?
The InChIKey is JRYLCGMHJYEYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20.8CH4/c1-3-5-9-12(4-2)13-10-7-6-8-11-13;;;;;;;;/h6-8,10-12H,3-5,9H2,1-2H3;8*1H4.
What are the key properties of heptan-3-ylbenzene;methane?
heptan-3-ylbenzene;methane has a molecular weight of 304.65 g/mol, XLogP of 9.46, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-3-ylbenzene;methane is sourced from PubChem (CID 159006232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).