About 3-phenylheptanal
3-phenylheptanal (PubChem CID 10954355) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-phenylheptanal.
Molecular Properties
| Compound Name | 3-phenylheptanal |
| PubChem CID | 10954355 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 3-phenylheptanal |
| SMILES | CCCCC(CC=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-2-3-7-13(10-11-14)12-8-5-4-6-9-12/h4-6,8-9,11,13H,2-3,7,10H2,1H3 |
| InChIKey | DNHWPDVVUDCAEZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylheptanal?
The IUPAC name of 3-phenylheptanal (CID 10954355) is 3-phenylheptanal.
What is the SMILES notation for 3-phenylheptanal?
The canonical SMILES for 3-phenylheptanal is CCCCC(CC=O)c1ccccc1.
What is the InChIKey of 3-phenylheptanal?
The InChIKey is DNHWPDVVUDCAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-2-3-7-13(10-11-14)12-8-5-4-6-9-12/h4-6,8-9,11,13H,2-3,7,10H2,1H3.
What are the key properties of 3-phenylheptanal?
3-phenylheptanal has a molecular weight of 190.29 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylheptanal is sourced from PubChem (CID 10954355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).