C14H22ClN — CID 3046459
N,N-dimethyl-3-phenylhex-5-en-1-amine;hydrochloride (PubChem CID 3046459) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is N,N-dimethyl-3-phenylhex-5-en-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-phenylhex-5-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3046459 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N,N-dimethyl-3-phenylhex-5-en-1-amine;hydrochloride |
| SMILES | C=CCC(CCN(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C14H21N.ClH/c1-4-8-13(11-12-15(2)3)14-9-6-5-7-10-14;/h4-7,9-10,13H,1,8,11-12H2,2-3H3;1H |
| InChIKey | UEXFQJZLRSCDJZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|