C19H20O — CID 22894004
1,4-diphenylhept-6-en-1-one (PubChem CID 22894004) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1,4-diphenylhept-6-en-1-one.
| Compound Name | 1,4-diphenylhept-6-en-1-one |
|---|---|
| PubChem CID | 22894004 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1,4-diphenylhept-6-en-1-one |
| SMILES | C=CCC(CCC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O/c1-2-9-16(17-10-5-3-6-11-17)14-15-19(20)18-12-7-4-8-13-18/h2-8,10-13,16H,1,9,14-15H2 |
| InChIKey | NDVKKZJMNGWACW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|