C20H26OSi — CID 102209299
1,4-diphenyl-5-trimethylsilylpentan-1-one (PubChem CID 102209299) has the molecular formula C20H26OSi and a molecular weight of 310.51 g/mol. Its IUPAC name is 1,4-diphenyl-5-trimethylsilylpentan-1-one.
| Compound Name | 1,4-diphenyl-5-trimethylsilylpentan-1-one |
|---|---|
| PubChem CID | 102209299 |
| Molecular Formula | C20H26OSi |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1,4-diphenyl-5-trimethylsilylpentan-1-one |
| SMILES | C[Si](C)(C)CC(CCC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi/c1-22(2,3)16-19(17-10-6-4-7-11-17)14-15-20(21)18-12-8-5-9-13-18/h4-13,19H,14-16H2,1-3H3 |
| InChIKey | PWVKGDINPFFSFU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|