About 6-phenyloctan-3-one
6-phenyloctan-3-one (PubChem CID 83936524) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 6-phenyloctan-3-one.
Molecular Properties
| Compound Name | 6-phenyloctan-3-one |
| PubChem CID | 83936524 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 6-phenyloctan-3-one |
| SMILES | CCC(=O)CCC(CC)c1ccccc1 |
| InChI | InChI=1S/C14H20O/c1-3-12(10-11-14(15)4-2)13-8-6-5-7-9-13/h5-9,12H,3-4,10-11H2,1-2H3 |
| InChIKey | ZBHBCSQXUUCGKB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-phenyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyloctan-3-one?
The IUPAC name of 6-phenyloctan-3-one (CID 83936524) is 6-phenyloctan-3-one.
What is the SMILES notation for 6-phenyloctan-3-one?
The canonical SMILES for 6-phenyloctan-3-one is CCC(=O)CCC(CC)c1ccccc1.
What is the InChIKey of 6-phenyloctan-3-one?
The InChIKey is ZBHBCSQXUUCGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-3-12(10-11-14(15)4-2)13-8-6-5-7-9-13/h5-9,12H,3-4,10-11H2,1-2H3.
What are the key properties of 6-phenyloctan-3-one?
6-phenyloctan-3-one has a molecular weight of 204.31 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyloctan-3-one is sourced from PubChem (CID 83936524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).