C14H21NO2 — CID 69271345
2-(aminomethyl)-5-phenylheptanoic acid (PubChem CID 69271345) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(aminomethyl)-5-phenylheptanoic acid.
| Compound Name | 2-(aminomethyl)-5-phenylheptanoic acid |
|---|---|
| PubChem CID | 69271345 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(aminomethyl)-5-phenylheptanoic acid |
| SMILES | CCC(CCC(CN)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-2-11(12-6-4-3-5-7-12)8-9-13(10-15)14(16)17/h3-7,11,13H,2,8-10,15H2,1H3,(H,16,17) |
| InChIKey | NECMKUCRBATJGC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |