About 5-phenylheptan-2-amine
5-phenylheptan-2-amine (PubChem CID 83936540) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 5-phenylheptan-2-amine.
Molecular Properties
| Compound Name | 5-phenylheptan-2-amine |
| PubChem CID | 83936540 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 5-phenylheptan-2-amine |
| SMILES | CCC(CCC(C)N)c1ccccc1 |
| InChI | InChI=1S/C13H21N/c1-3-12(10-9-11(2)14)13-7-5-4-6-8-13/h4-8,11-12H,3,9-10,14H2,1-2H3 |
| InChIKey | ZKNPZDIUNXCHAN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-phenylheptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylheptan-2-amine?
The IUPAC name of 5-phenylheptan-2-amine (CID 83936540) is 5-phenylheptan-2-amine.
What is the SMILES notation for 5-phenylheptan-2-amine?
The canonical SMILES for 5-phenylheptan-2-amine is CCC(CCC(C)N)c1ccccc1.
What is the InChIKey of 5-phenylheptan-2-amine?
The InChIKey is ZKNPZDIUNXCHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-3-12(10-9-11(2)14)13-7-5-4-6-8-13/h4-8,11-12H,3,9-10,14H2,1-2H3.
What are the key properties of 5-phenylheptan-2-amine?
5-phenylheptan-2-amine has a molecular weight of 191.32 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylheptan-2-amine is sourced from PubChem (CID 83936540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).