About azane;pentan-3-ylbenzene
azane;pentan-3-ylbenzene (PubChem CID 19774895) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is azane;pentan-3-ylbenzene.
Molecular Properties
| Compound Name | azane;pentan-3-ylbenzene |
| PubChem CID | 19774895 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | azane;pentan-3-ylbenzene |
| SMILES | CCC(CC)c1ccccc1.N.N |
| InChI | InChI=1S/C11H16.2H3N/c1-3-10(4-2)11-8-6-5-7-9-11;;/h5-10H,3-4H2,1-2H3;2*1H3 |
| InChIKey | VDWUWBWVURNYTK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;pentan-3-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;pentan-3-ylbenzene?
The IUPAC name of azane;pentan-3-ylbenzene (CID 19774895) is azane;pentan-3-ylbenzene.
What is the SMILES notation for azane;pentan-3-ylbenzene?
The canonical SMILES for azane;pentan-3-ylbenzene is CCC(CC)c1ccccc1.N.N.
What is the InChIKey of azane;pentan-3-ylbenzene?
The InChIKey is VDWUWBWVURNYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.2H3N/c1-3-10(4-2)11-8-6-5-7-9-11;;/h5-10H,3-4H2,1-2H3;2*1H3.
What are the key properties of azane;pentan-3-ylbenzene?
azane;pentan-3-ylbenzene has a molecular weight of 182.31 g/mol, XLogP of 3.91, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;pentan-3-ylbenzene is sourced from PubChem (CID 19774895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).