About ethane;3-phenylpentanoic acid
ethane;3-phenylpentanoic acid (PubChem CID 142147200) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is ethane;3-phenylpentanoic acid.
Molecular Properties
| Compound Name | ethane;3-phenylpentanoic acid |
| PubChem CID | 142147200 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | ethane;3-phenylpentanoic acid |
| SMILES | CC.CCC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2.C2H6/c1-2-9(8-11(12)13)10-6-4-3-5-7-10;1-2/h3-7,9H,2,8H2,1H3,(H,12,13);1-2H3 |
| InChIKey | GUZTYSDAAXYNFQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-phenylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-phenylpentanoic acid?
The IUPAC name of ethane;3-phenylpentanoic acid (CID 142147200) is ethane;3-phenylpentanoic acid.
What is the SMILES notation for ethane;3-phenylpentanoic acid?
The canonical SMILES for ethane;3-phenylpentanoic acid is CC.CCC(CC(=O)O)c1ccccc1.
What is the InChIKey of ethane;3-phenylpentanoic acid?
The InChIKey is GUZTYSDAAXYNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C2H6/c1-2-9(8-11(12)13)10-6-4-3-5-7-10;1-2/h3-7,9H,2,8H2,1H3,(H,12,13);1-2H3.
What are the key properties of ethane;3-phenylpentanoic acid?
ethane;3-phenylpentanoic acid has a molecular weight of 208.30 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-phenylpentanoic acid is sourced from PubChem (CID 142147200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).