(3S)-3-phenylpentanoyl chloride

C11H13ClO — CID 42074098

IUPAC(3S)-3-phenylpentanoyl chloride
SMILESCC[C@@H](CC(=O)Cl)c1ccccc1
InChIInChI=1S/C11H13ClO/c1-2-9(8-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3/t9-/m0/s1
InChIKeySZJINQFRQKBHDJ-VIFPVBQESA-N
MW196.68 g/mol
LogP3.34
Rot. Bonds4

About (3S)-3-phenylpentanoyl chloride

(3S)-3-phenylpentanoyl chloride (PubChem CID 42074098) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is (3S)-3-phenylpentanoyl chloride.

Molecular Properties

Compound Name(3S)-3-phenylpentanoyl chloride
PubChem CID42074098
Molecular FormulaC11H13ClO
Molecular Weight196.68 g/mol
Exact Mass196.07
IUPAC Name(3S)-3-phenylpentanoyl chloride
SMILESCC[C@@H](CC(=O)Cl)c1ccccc1
InChIInChI=1S/C11H13ClO/c1-2-9(8-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3/t9-/m0/s1
InChIKeySZJINQFRQKBHDJ-VIFPVBQESA-N
XLogP3.34
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.68
LogP ≤ 53.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (3S)-3-phenylpentanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-phenylpentanoyl chloride?
The IUPAC name of (3S)-3-phenylpentanoyl chloride (CID 42074098) is (3S)-3-phenylpentanoyl chloride.
What is the SMILES notation for (3S)-3-phenylpentanoyl chloride?
The canonical SMILES for (3S)-3-phenylpentanoyl chloride is CC[C@@H](CC(=O)Cl)c1ccccc1.
What is the InChIKey of (3S)-3-phenylpentanoyl chloride?
The InChIKey is SZJINQFRQKBHDJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13ClO/c1-2-9(8-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-phenylpentanoyl chloride?
(3S)-3-phenylpentanoyl chloride has a molecular weight of 196.68 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-phenylpentanoyl chloride is sourced from PubChem (CID 42074098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).