About (3S)-3-phenylpentanoyl chloride
(3S)-3-phenylpentanoyl chloride (PubChem CID 42074098) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is (3S)-3-phenylpentanoyl chloride.
Molecular Properties
| Compound Name | (3S)-3-phenylpentanoyl chloride |
| PubChem CID | 42074098 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3S)-3-phenylpentanoyl chloride |
| SMILES | CC[C@@H](CC(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H13ClO/c1-2-9(8-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3/t9-/m0/s1 |
| InChIKey | SZJINQFRQKBHDJ-VIFPVBQESA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-phenylpentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-phenylpentanoyl chloride?
The IUPAC name of (3S)-3-phenylpentanoyl chloride (CID 42074098) is (3S)-3-phenylpentanoyl chloride.
What is the SMILES notation for (3S)-3-phenylpentanoyl chloride?
The canonical SMILES for (3S)-3-phenylpentanoyl chloride is CC[C@@H](CC(=O)Cl)c1ccccc1.
What is the InChIKey of (3S)-3-phenylpentanoyl chloride?
The InChIKey is SZJINQFRQKBHDJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13ClO/c1-2-9(8-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-phenylpentanoyl chloride?
(3S)-3-phenylpentanoyl chloride has a molecular weight of 196.68 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-phenylpentanoyl chloride is sourced from PubChem (CID 42074098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).