C17H18O4 — CID 176881925
3-phenyl-1-(2,4,6-trihydroxyphenyl)pentan-1-one (PubChem CID 176881925) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-phenyl-1-(2,4,6-trihydroxyphenyl)pentan-1-one.
| Compound Name | 3-phenyl-1-(2,4,6-trihydroxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 176881925 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-phenyl-1-(2,4,6-trihydroxyphenyl)pentan-1-one |
| SMILES | CCC(CC(=O)c1c(O)cc(O)cc1O)c1ccccc1 |
| InChI | InChI=1S/C17H18O4/c1-2-11(12-6-4-3-5-7-12)8-14(19)17-15(20)9-13(18)10-16(17)21/h3-7,9-11,18,20-21H,2,8H2,1H3 |
| InChIKey | FAXRDMXZFADKGS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |