About 3-phenylpentanedioyl dichloride
3-phenylpentanedioyl dichloride (PubChem CID 19103905) has the molecular formula C11H10Cl2O2
and a molecular weight of 245.10 g/mol. Its IUPAC name is 3-phenylpentanedioyl dichloride.
Molecular Properties
| Compound Name | 3-phenylpentanedioyl dichloride |
| PubChem CID | 19103905 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 3-phenylpentanedioyl dichloride |
| SMILES | O=C(Cl)CC(CC(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H10Cl2O2/c12-10(14)6-9(7-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | COGSBWUZTAWTMC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpentanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpentanedioyl dichloride?
The IUPAC name of 3-phenylpentanedioyl dichloride (CID 19103905) is 3-phenylpentanedioyl dichloride.
What is the SMILES notation for 3-phenylpentanedioyl dichloride?
The canonical SMILES for 3-phenylpentanedioyl dichloride is O=C(Cl)CC(CC(=O)Cl)c1ccccc1.
What is the InChIKey of 3-phenylpentanedioyl dichloride?
The InChIKey is COGSBWUZTAWTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O2/c12-10(14)6-9(7-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of 3-phenylpentanedioyl dichloride?
3-phenylpentanedioyl dichloride has a molecular weight of 245.10 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpentanedioyl dichloride is sourced from PubChem (CID 19103905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).