C21H18N2O2 — CID 11290437
3-phenyl-1,5-dipyridin-4-ylpentane-1,5-dione (PubChem CID 11290437) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-phenyl-1,5-dipyridin-4-ylpentane-1,5-dione.
| Compound Name | 3-phenyl-1,5-dipyridin-4-ylpentane-1,5-dione |
|---|---|
| PubChem CID | 11290437 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-phenyl-1,5-dipyridin-4-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccncc1)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H18N2O2/c24-20(17-6-10-22-11-7-17)14-19(16-4-2-1-3-5-16)15-21(25)18-8-12-23-13-9-18/h1-13,19H,14-15H2 |
| InChIKey | FLEFOBZTQLUBAM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |