C22H17N3O6 — CID 155801921
1,5-bis(4-nitrophenyl)-3-pyridin-4-ylpentane-1,5-dione (PubChem CID 155801921) has the molecular formula C22H17N3O6 and a molecular weight of 419.39 g/mol. Its IUPAC name is 1,5-bis(4-nitrophenyl)-3-pyridin-4-ylpentane-1,5-dione.
| Compound Name | 1,5-bis(4-nitrophenyl)-3-pyridin-4-ylpentane-1,5-dione |
|---|---|
| PubChem CID | 155801921 |
| Molecular Formula | C22H17N3O6 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1,5-bis(4-nitrophenyl)-3-pyridin-4-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccc([N+](=O)[O-])cc1)c1ccncc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H17N3O6/c26-21(16-1-5-19(6-2-16)24(28)29)13-18(15-9-11-23-12-10-15)14-22(27)17-3-7-20(8-4-17)25(30)31/h1-12,18H,13-14H2 |
| InChIKey | FOORDQBJWMXNCK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 133.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|