C22H16F3N3O5 — CID 141169778
3-(4-nitroanilino)-1-(4-nitrophenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 141169778) has the molecular formula C22H16F3N3O5 and a molecular weight of 459.38 g/mol. Its IUPAC name is 3-(4-nitroanilino)-1-(4-nitrophenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 3-(4-nitroanilino)-1-(4-nitrophenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 141169778 |
| Molecular Formula | C22H16F3N3O5 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 3-(4-nitroanilino)-1-(4-nitrophenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | O=C(CC(Nc1ccc([N+](=O)[O-])cc1)c1ccc(C(F)(F)F)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H16F3N3O5/c23-22(24,25)16-5-1-14(2-6-16)20(26-17-7-11-19(12-8-17)28(32)33)13-21(29)15-3-9-18(10-4-15)27(30)31/h1-12,20,26H,13H2 |
| InChIKey | CFUOGHAXVVWFPZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|