C25H23ClN2O9 — CID 46244525
1-(4-chlorophenyl)-3-(4-nitroanilino)-3-phenylpropan-1-one;2,3-dihydroxybutanedioic acid (PubChem CID 46244525) has the molecular formula C25H23ClN2O9 and a molecular weight of 530.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-nitroanilino)-3-phenylpropan-1-one;2,3-dihydroxybutanedioic acid.
| Compound Name | 1-(4-chlorophenyl)-3-(4-nitroanilino)-3-phenylpropan-1-one;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 46244525 |
| Molecular Formula | C25H23ClN2O9 |
| Molecular Weight | 530.92 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-nitroanilino)-3-phenylpropan-1-one;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(CC(Nc1ccc([N+](=O)[O-])cc1)c1ccccc1)c1ccc(Cl)cc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C21H17ClN2O3.C4H6O6/c22-17-8-6-16(7-9-17)21(25)14-20(15-4-2-1-3-5-15)23-18-10-12-19(13-11-18)24(26)27;5-1(3(7)8)2(6)4(9)10/h1-13,20,23H,14H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | OBMPBWKGJMOMQE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 187.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|