C21H17Cl2N3O5S — CID 141204389
4-[[3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)-3-oxopropyl]amino]benzenesulfonamide (PubChem CID 141204389) has the molecular formula C21H17Cl2N3O5S and a molecular weight of 494.36 g/mol. Its IUPAC name is 4-[[3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)-3-oxopropyl]amino]benzenesulfonamide.
| Compound Name | 4-[[3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)-3-oxopropyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 141204389 |
| Molecular Formula | C21H17Cl2N3O5S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 4-[[3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)-3-oxopropyl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC(CC(=O)c2ccc(Cl)c(Cl)c2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O5S/c22-18-10-3-14(11-19(18)23)21(27)12-20(13-1-6-16(7-2-13)26(28)29)25-15-4-8-17(9-5-15)32(24,30)31/h1-11,20,25H,12H2,(H2,24,30,31) |
| InChIKey | ULDDQKRMQABYHI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|