C22H18Cl2N2O4 — CID 132592354
3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-3-(3-nitroanilino)propan-1-one (PubChem CID 132592354) has the molecular formula C22H18Cl2N2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-3-(3-nitroanilino)propan-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-3-(3-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 132592354 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-3-(3-nitroanilino)propan-1-one |
| SMILES | COc1ccc(C(=O)CC(Nc2cccc([N+](=O)[O-])c2)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O4/c1-30-18-8-5-14(6-9-18)22(27)13-21(15-7-10-19(23)20(24)11-15)25-16-3-2-4-17(12-16)26(28)29/h2-12,21,25H,13H2,1H3 |
| InChIKey | HJNHZTZXLOQNLV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|