C23H21ClN2O5 — CID 132591657
1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)propan-1-one (PubChem CID 132591657) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)propan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 132591657 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)propan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccc(Cl)cc2)Nc2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C23H21ClN2O5/c1-30-22-11-8-16(12-23(22)31-2)20(14-21(27)15-6-9-17(24)10-7-15)25-18-4-3-5-19(13-18)26(28)29/h3-13,20,25H,14H2,1-2H3 |
| InChIKey | OVEKTHGKJPJIKH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|