C22H20N2O4 — CID 132592363
3-(4-methoxyphenyl)-3-(3-nitroanilino)-1-phenylpropan-1-one (PubChem CID 132592363) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3-(3-nitroanilino)-1-phenylpropan-1-one.
| Compound Name | 3-(4-methoxyphenyl)-3-(3-nitroanilino)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 132592363 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-3-(3-nitroanilino)-1-phenylpropan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-28-20-12-10-16(11-13-20)21(15-22(25)17-6-3-2-4-7-17)23-18-8-5-9-19(14-18)24(26)27/h2-14,21,23H,15H2,1H3 |
| InChIKey | HPUOEKLJJKLVKX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|