C22H19IN2O4 — CID 132592203
3-(4-iodoanilino)-1-(4-methoxyphenyl)-3-(3-nitrophenyl)propan-1-one (PubChem CID 132592203) has the molecular formula C22H19IN2O4 and a molecular weight of 502.31 g/mol. Its IUPAC name is 3-(4-iodoanilino)-1-(4-methoxyphenyl)-3-(3-nitrophenyl)propan-1-one.
| Compound Name | 3-(4-iodoanilino)-1-(4-methoxyphenyl)-3-(3-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 132592203 |
| Molecular Formula | C22H19IN2O4 |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 3-(4-iodoanilino)-1-(4-methoxyphenyl)-3-(3-nitrophenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CC(Nc2ccc(I)cc2)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H19IN2O4/c1-29-20-11-5-15(6-12-20)22(26)14-21(24-18-9-7-17(23)8-10-18)16-3-2-4-19(13-16)25(27)28/h2-13,21,24H,14H2,1H3 |
| InChIKey | WDODBAOQWDTSDX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|