C26H28INO3 — CID 98419479
(3R)-3-(4-butoxyphenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one (PubChem CID 98419479) has the molecular formula C26H28INO3 and a molecular weight of 529.42 g/mol. Its IUPAC name is (3R)-3-(4-butoxyphenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one.
| Compound Name | (3R)-3-(4-butoxyphenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 98419479 |
| Molecular Formula | C26H28INO3 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | (3R)-3-(4-butoxyphenyl)-3-(4-iodoanilino)-1-(4-methoxyphenyl)propan-1-one |
| SMILES | CCCCOc1ccc([C@@H](CC(=O)c2ccc(OC)cc2)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C26H28INO3/c1-3-4-17-31-24-15-5-19(6-16-24)25(28-22-11-9-21(27)10-12-22)18-26(29)20-7-13-23(30-2)14-8-20/h5-16,25,28H,3-4,17-18H2,1-2H3/t25-/m1/s1 |
| InChIKey | WNMUPUYOSFLXRN-RUZDIDTESA-N |
| XLogP | 6.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|