C29H34FNO2 — CID 40823115
(3R)-3-(4-butoxyphenyl)-1-(4-tert-butylphenyl)-3-(4-fluoroanilino)propan-1-one (PubChem CID 40823115) has the molecular formula C29H34FNO2 and a molecular weight of 447.59 g/mol. Its IUPAC name is (3R)-3-(4-butoxyphenyl)-1-(4-tert-butylphenyl)-3-(4-fluoroanilino)propan-1-one.
| Compound Name | (3R)-3-(4-butoxyphenyl)-1-(4-tert-butylphenyl)-3-(4-fluoroanilino)propan-1-one |
|---|---|
| PubChem CID | 40823115 |
| Molecular Formula | C29H34FNO2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (3R)-3-(4-butoxyphenyl)-1-(4-tert-butylphenyl)-3-(4-fluoroanilino)propan-1-one |
| SMILES | CCCCOc1ccc([C@@H](CC(=O)c2ccc(C(C)(C)C)cc2)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H34FNO2/c1-5-6-19-33-26-17-9-21(10-18-26)27(31-25-15-13-24(30)14-16-25)20-28(32)22-7-11-23(12-8-22)29(2,3)4/h7-18,27,31H,5-6,19-20H2,1-4H3/t27-/m1/s1 |
| InChIKey | UFRSRYIRDGWLPU-HHHXNRCGSA-N |
| XLogP | 7.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|