C24H24ClNO3 — CID 7290250
(3R)-3-(4-chloroanilino)-3-(4-ethoxyphenyl)-1-(4-methoxyphenyl)propan-1-one (PubChem CID 7290250) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is (3R)-3-(4-chloroanilino)-3-(4-ethoxyphenyl)-1-(4-methoxyphenyl)propan-1-one.
| Compound Name | (3R)-3-(4-chloroanilino)-3-(4-ethoxyphenyl)-1-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 7290250 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (3R)-3-(4-chloroanilino)-3-(4-ethoxyphenyl)-1-(4-methoxyphenyl)propan-1-one |
| SMILES | CCOc1ccc([C@@H](CC(=O)c2ccc(OC)cc2)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H24ClNO3/c1-3-29-22-14-4-17(5-15-22)23(26-20-10-8-19(25)9-11-20)16-24(27)18-6-12-21(28-2)13-7-18/h4-15,23,26H,3,16H2,1-2H3/t23-/m1/s1 |
| InChIKey | CJNALALWIVKQMF-HSZRJFAPSA-N |
| XLogP | 6.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |