C23H22BrNO3 — CID 94844105
(3S)-1-(4-bromophenyl)-3-(4-methoxyanilino)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 94844105) has the molecular formula C23H22BrNO3 and a molecular weight of 440.34 g/mol. Its IUPAC name is (3S)-1-(4-bromophenyl)-3-(4-methoxyanilino)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | (3S)-1-(4-bromophenyl)-3-(4-methoxyanilino)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 94844105 |
| Molecular Formula | C23H22BrNO3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | (3S)-1-(4-bromophenyl)-3-(4-methoxyanilino)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(N[C@@H](CC(=O)c2ccc(Br)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22BrNO3/c1-27-20-11-5-16(6-12-20)22(25-19-9-13-21(28-2)14-10-19)15-23(26)17-3-7-18(24)8-4-17/h3-14,22,25H,15H2,1-2H3/t22-/m0/s1 |
| InChIKey | XECDCZWFKBSFRT-QFIPXVFZSA-N |
| XLogP | 5.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|