C24H23Cl2NO2 — CID 132593520
3-(3,4-dichlorophenyl)-3-(4-ethoxyanilino)-1-(4-methylphenyl)propan-1-one (PubChem CID 132593520) has the molecular formula C24H23Cl2NO2 and a molecular weight of 428.36 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(4-ethoxyanilino)-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(4-ethoxyanilino)-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 132593520 |
| Molecular Formula | C24H23Cl2NO2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(4-ethoxyanilino)-1-(4-methylphenyl)propan-1-one |
| SMILES | CCOc1ccc(NC(CC(=O)c2ccc(C)cc2)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23Cl2NO2/c1-3-29-20-11-9-19(10-12-20)27-23(18-8-13-21(25)22(26)14-18)15-24(28)17-6-4-16(2)5-7-17/h4-14,23,27H,3,15H2,1-2H3 |
| InChIKey | LFMRNFVMYNNYJN-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|