C24H25NO — CID 132593466
3-(4-methylanilino)-1,3-bis(4-methylphenyl)propan-1-one (PubChem CID 132593466) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-(4-methylanilino)-1,3-bis(4-methylphenyl)propan-1-one.
| Compound Name | 3-(4-methylanilino)-1,3-bis(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 132593466 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-(4-methylanilino)-1,3-bis(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(NC(CC(=O)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NO/c1-17-4-10-20(11-5-17)23(25-22-14-8-19(3)9-15-22)16-24(26)21-12-6-18(2)7-13-21/h4-15,23,25H,16H2,1-3H3 |
| InChIKey | KPEAJYPKGKFVPE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |