C22H19ClINO — CID 132593475
3-(4-chlorophenyl)-3-(4-iodoanilino)-1-(4-methylphenyl)propan-1-one (PubChem CID 132593475) has the molecular formula C22H19ClINO and a molecular weight of 475.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(4-iodoanilino)-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-(4-chlorophenyl)-3-(4-iodoanilino)-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 132593475 |
| Molecular Formula | C22H19ClINO |
| Molecular Weight | 475.76 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(4-iodoanilino)-1-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CC(Nc2ccc(I)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H19ClINO/c1-15-2-4-17(5-3-15)22(26)14-21(16-6-8-18(23)9-7-16)25-20-12-10-19(24)11-13-20/h2-13,21,25H,14H2,1H3 |
| InChIKey | MLWKLEFXBXPSQV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|