C26H28ClNO — CID 17384326
3-(4-butylanilino)-3-(4-chlorophenyl)-1-(4-methylphenyl)propan-1-one (PubChem CID 17384326) has the molecular formula C26H28ClNO and a molecular weight of 405.97 g/mol. Its IUPAC name is 3-(4-butylanilino)-3-(4-chlorophenyl)-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-(4-butylanilino)-3-(4-chlorophenyl)-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 17384326 |
| Molecular Formula | C26H28ClNO |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-(4-butylanilino)-3-(4-chlorophenyl)-1-(4-methylphenyl)propan-1-one |
| SMILES | CCCCc1ccc(NC(CC(=O)c2ccc(C)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H28ClNO/c1-3-4-5-20-8-16-24(17-9-20)28-25(21-12-14-23(27)15-13-21)18-26(29)22-10-6-19(2)7-11-22/h6-17,25,28H,3-5,18H2,1-2H3 |
| InChIKey | ZDEMOFMQOYISCC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |