C25H26INO — CID 4010443
3-(4-ethylanilino)-1-(4-ethylphenyl)-3-(4-iodophenyl)propan-1-one (PubChem CID 4010443) has the molecular formula C25H26INO and a molecular weight of 483.39 g/mol. Its IUPAC name is 3-(4-ethylanilino)-1-(4-ethylphenyl)-3-(4-iodophenyl)propan-1-one.
| Compound Name | 3-(4-ethylanilino)-1-(4-ethylphenyl)-3-(4-iodophenyl)propan-1-one |
|---|---|
| PubChem CID | 4010443 |
| Molecular Formula | C25H26INO |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-(4-ethylanilino)-1-(4-ethylphenyl)-3-(4-iodophenyl)propan-1-one |
| SMILES | CCc1ccc(NC(CC(=O)c2ccc(CC)cc2)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C25H26INO/c1-3-18-5-9-21(10-6-18)25(28)17-24(20-11-13-22(26)14-12-20)27-23-15-7-19(4-2)8-16-23/h5-16,24,27H,3-4,17H2,1-2H3 |
| InChIKey | ZTSAFROUOOZZQW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|