C24H25NOS — CID 39368809
(3R)-3-anilino-1-(4-ethylphenyl)-3-(4-methylsulfanylphenyl)propan-1-one (PubChem CID 39368809) has the molecular formula C24H25NOS and a molecular weight of 375.54 g/mol. Its IUPAC name is (3R)-3-anilino-1-(4-ethylphenyl)-3-(4-methylsulfanylphenyl)propan-1-one.
| Compound Name | (3R)-3-anilino-1-(4-ethylphenyl)-3-(4-methylsulfanylphenyl)propan-1-one |
|---|---|
| PubChem CID | 39368809 |
| Molecular Formula | C24H25NOS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (3R)-3-anilino-1-(4-ethylphenyl)-3-(4-methylsulfanylphenyl)propan-1-one |
| SMILES | CCc1ccc(C(=O)C[C@@H](Nc2ccccc2)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C24H25NOS/c1-3-18-9-11-20(12-10-18)24(26)17-23(25-21-7-5-4-6-8-21)19-13-15-22(27-2)16-14-19/h4-16,23,25H,3,17H2,1-2H3/t23-/m1/s1 |
| InChIKey | CAAWTXPNXYIZEN-HSZRJFAPSA-N |
| XLogP | 6.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |