C24H25NO — CID 154717560
1,3-diphenyl-3-(4-propan-2-ylanilino)propan-1-one (PubChem CID 154717560) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is 1,3-diphenyl-3-(4-propan-2-ylanilino)propan-1-one.
| Compound Name | 1,3-diphenyl-3-(4-propan-2-ylanilino)propan-1-one |
|---|---|
| PubChem CID | 154717560 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1,3-diphenyl-3-(4-propan-2-ylanilino)propan-1-one |
| SMILES | CC(C)c1ccc(NC(CC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO/c1-18(2)19-13-15-22(16-14-19)25-23(20-9-5-3-6-10-20)17-24(26)21-11-7-4-8-12-21/h3-16,18,23,25H,17H2,1-2H3 |
| InChIKey | XLVHNSQRNWXWAS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |