C24H23ClINO — CID 132591671
1-(4-chlorophenyl)-3-(4-iodoanilino)-3-(4-propan-2-ylphenyl)propan-1-one (PubChem CID 132591671) has the molecular formula C24H23ClINO and a molecular weight of 503.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-iodoanilino)-3-(4-propan-2-ylphenyl)propan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-(4-iodoanilino)-3-(4-propan-2-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 132591671 |
| Molecular Formula | C24H23ClINO |
| Molecular Weight | 503.81 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-iodoanilino)-3-(4-propan-2-ylphenyl)propan-1-one |
| SMILES | CC(C)c1ccc(C(CC(=O)c2ccc(Cl)cc2)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C24H23ClINO/c1-16(2)17-3-5-18(6-4-17)23(27-22-13-11-21(26)12-14-22)15-24(28)19-7-9-20(25)10-8-19/h3-14,16,23,27H,15H2,1-2H3 |
| InChIKey | NOJPRDDFUZOACY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.81 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|